C18H23N3O5S — CID 9087310
1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-N-(2-hydroxy-4-methylphenyl)piperidine-4-carboxamide (PubChem CID 9087310) has the molecular formula C18H23N3O5S and a molecular weight of 393.47 g/mol. Its IUPAC name is 1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-N-(2-hydroxy-4-methylphenyl)piperidine-4-carboxamide.
| Compound Name | 1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-N-(2-hydroxy-4-methylphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 9087310 |
| Molecular Formula | C18H23N3O5S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-N-(2-hydroxy-4-methylphenyl)piperidine-4-carboxamide |
| SMILES | Cc1ccc(NC(=O)C2CCN(S(=O)(=O)c3c(C)noc3C)CC2)c(O)c1 |
| InChI | InChI=1S/C18H23N3O5S/c1-11-4-5-15(16(22)10-11)19-18(23)14-6-8-21(9-7-14)27(24,25)17-12(2)20-26-13(17)3/h4-5,10,14,22H,6-9H2,1-3H3,(H,19,23) |
| InChIKey | DXDOVIGGQONTHW-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 112.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|