C26H24F7NO4 — CID 90873345
methyl (6R,7S,8S)-6-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-7-(4-fluorophenyl)-5-methyl-3-oxo-1,2,5,6,7,8-hexahydropyrrolizine-2-carboxylate (PubChem CID 90873345) has the molecular formula C26H24F7NO4 and a molecular weight of 547.47 g/mol. Its IUPAC name is methyl (6R,7S,8S)-6-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-7-(4-fluorophenyl)-5-methyl-3-oxo-1,2,5,6,7,8-hexahydropyrrolizine-2-carboxylate.
| Compound Name | methyl (6R,7S,8S)-6-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-7-(4-fluorophenyl)-5-methyl-3-oxo-1,2,5,6,7,8-hexahydropyrrolizine-2-carboxylate |
|---|---|
| PubChem CID | 90873345 |
| Molecular Formula | C26H24F7NO4 |
| Molecular Weight | 547.47 g/mol |
| Exact Mass | 547.16 |
| IUPAC Name | methyl (6R,7S,8S)-6-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-7-(4-fluorophenyl)-5-methyl-3-oxo-1,2,5,6,7,8-hexahydropyrrolizine-2-carboxylate |
| SMILES | COC(=O)C1C[C@H]2[C@H](c3ccc(F)cc3)[C@@H](O[C@H](C)c3cc(C(F)(F)F)cc(C(F)(F)F)c3)C(C)N2C1=O |
| InChI | InChI=1S/C26H24F7NO4/c1-12-22(38-13(2)15-8-16(25(28,29)30)10-17(9-15)26(31,32)33)21(14-4-6-18(27)7-5-14)20-11-19(24(36)37-3)23(35)34(12)20/h4-10,12-13,19-22H,11H2,1-3H3/t12?,13-,19?,20+,21+,22+/m1/s1 |
| InChIKey | CVZABESALBWMQX-DETVLKTESA-N |
| XLogP | 5.89 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.47 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|