C28H33FN4O4S — CID 90873432
(3S)-4-[[2-(1-benzothiophene-2-carbonylamino)-4-methylpentanoyl]amino]-N-(2-fluorophenyl)-3-hydroxyazepane-1-carboxamide (PubChem CID 90873432) has the molecular formula C28H33FN4O4S and a molecular weight of 540.66 g/mol. Its IUPAC name is (3S)-4-[[2-(1-benzothiophene-2-carbonylamino)-4-methylpentanoyl]amino]-N-(2-fluorophenyl)-3-hydroxyazepane-1-carboxamide.
| Compound Name | (3S)-4-[[2-(1-benzothiophene-2-carbonylamino)-4-methylpentanoyl]amino]-N-(2-fluorophenyl)-3-hydroxyazepane-1-carboxamide |
|---|---|
| PubChem CID | 90873432 |
| Molecular Formula | C28H33FN4O4S |
| Molecular Weight | 540.66 g/mol |
| Exact Mass | 540.22 |
| IUPAC Name | (3S)-4-[[2-(1-benzothiophene-2-carbonylamino)-4-methylpentanoyl]amino]-N-(2-fluorophenyl)-3-hydroxyazepane-1-carboxamide |
| SMILES | CC(C)CC(NC(=O)c1cc2ccccc2s1)C(=O)NC1CCCN(C(=O)Nc2ccccc2F)C[C@@H]1O |
| InChI | InChI=1S/C28H33FN4O4S/c1-17(2)14-22(31-27(36)25-15-18-8-3-6-12-24(18)38-25)26(35)30-21-11-7-13-33(16-23(21)34)28(37)32-20-10-5-4-9-19(20)29/h3-6,8-10,12,15,17,21-23,34H,7,11,13-14,16H2,1-2H3,(H,30,35)(H,31,36)(H,32,37)/t21?,22?,23-/m0/s1 |
| InChIKey | PDWOEUYIVFPUGI-VNXZQDSDSA-N |
| XLogP | 4.36 |
| TPSA | 110.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.66 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |