C20H23ClFNO4 — CID 90873816
4-(2-chloro-6-fluorophenyl)-3-(cyclopentylperoxymethyl)-2,6-dimethyl-3,4-dihydropyridine-5-carboxylic acid (PubChem CID 90873816) has the molecular formula C20H23ClFNO4 and a molecular weight of 395.86 g/mol. Its IUPAC name is 4-(2-chloro-6-fluorophenyl)-3-(cyclopentylperoxymethyl)-2,6-dimethyl-3,4-dihydropyridine-5-carboxylic acid.
| Compound Name | 4-(2-chloro-6-fluorophenyl)-3-(cyclopentylperoxymethyl)-2,6-dimethyl-3,4-dihydropyridine-5-carboxylic acid |
|---|---|
| PubChem CID | 90873816 |
| Molecular Formula | C20H23ClFNO4 |
| Molecular Weight | 395.86 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 4-(2-chloro-6-fluorophenyl)-3-(cyclopentylperoxymethyl)-2,6-dimethyl-3,4-dihydropyridine-5-carboxylic acid |
| SMILES | CC1=NC(C)=C(C(=O)O)C(c2c(F)cccc2Cl)C1COOC1CCCC1 |
| InChI | InChI=1S/C20H23ClFNO4/c1-11-14(10-26-27-13-6-3-4-7-13)18(17(20(24)25)12(2)23-11)19-15(21)8-5-9-16(19)22/h5,8-9,13-14,18H,3-4,6-7,10H2,1-2H3,(H,24,25) |
| InChIKey | LXRHKUSSOXTLDJ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.86 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|