C24H33N5OS — CID 90873937
N'-[ethenyl-[2-methoxy-6-[(4-phenyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)amino]hex-1-en-3-yl]amino]ethanimidamide (PubChem CID 90873937) has the molecular formula C24H33N5OS and a molecular weight of 439.63 g/mol. Its IUPAC name is N'-[ethenyl-[2-methoxy-6-[(4-phenyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)amino]hex-1-en-3-yl]amino]ethanimidamide.
| Compound Name | N'-[ethenyl-[2-methoxy-6-[(4-phenyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)amino]hex-1-en-3-yl]amino]ethanimidamide |
|---|---|
| PubChem CID | 90873937 |
| Molecular Formula | C24H33N5OS |
| Molecular Weight | 439.63 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | N'-[ethenyl-[2-methoxy-6-[(4-phenyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)amino]hex-1-en-3-yl]amino]ethanimidamide |
| SMILES | C=CN(N=C(C)N)C(CCCNc1nc2c(s1)CCCC2c1ccccc1)C(=C)OC |
| InChI | InChI=1S/C24H33N5OS/c1-5-29(28-18(3)25)21(17(2)30-4)14-10-16-26-24-27-23-20(13-9-15-22(23)31-24)19-11-7-6-8-12-19/h5-8,11-12,20-21H,1-2,9-10,13-16H2,3-4H3,(H2,25,28)(H,26,27) |
| InChIKey | KBSKTMXINBDEGR-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 75.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.63 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|