About 3-[2,5-dihydroxy-3-(methylamino)pyrrol-1-yl]hexane-2,5-dione
3-[2,5-dihydroxy-3-(methylamino)pyrrol-1-yl]hexane-2,5-dione (PubChem CID 90873962) has the molecular formula C11H16N2O4
and a molecular weight of 240.26 g/mol. Its IUPAC name is 3-[2,5-dihydroxy-3-(methylamino)pyrrol-1-yl]hexane-2,5-dione.
Molecular Properties
| Compound Name | 3-[2,5-dihydroxy-3-(methylamino)pyrrol-1-yl]hexane-2,5-dione |
| PubChem CID | 90873962 |
| Molecular Formula | C11H16N2O4 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 3-[2,5-dihydroxy-3-(methylamino)pyrrol-1-yl]hexane-2,5-dione |
| SMILES | CNc1cc(O)n(C(CC(C)=O)C(C)=O)c1O |
| InChI | InChI=1S/C11H16N2O4/c1-6(14)4-9(7(2)15)13-10(16)5-8(12-3)11(13)17/h5,9,12,16-17H,4H2,1-3H3 |
| InChIKey | USQGQFICZNKRCZ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[2,5-dihydroxy-3-(methylamino)pyrrol-1-yl]hexane-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2,5-dihydroxy-3-(methylamino)pyrrol-1-yl]hexane-2,5-dione?
The IUPAC name of 3-[2,5-dihydroxy-3-(methylamino)pyrrol-1-yl]hexane-2,5-dione (CID 90873962) is 3-[2,5-dihydroxy-3-(methylamino)pyrrol-1-yl]hexane-2,5-dione.
What is the SMILES notation for 3-[2,5-dihydroxy-3-(methylamino)pyrrol-1-yl]hexane-2,5-dione?
The canonical SMILES for 3-[2,5-dihydroxy-3-(methylamino)pyrrol-1-yl]hexane-2,5-dione is CNc1cc(O)n(C(CC(C)=O)C(C)=O)c1O.
What is the InChIKey of 3-[2,5-dihydroxy-3-(methylamino)pyrrol-1-yl]hexane-2,5-dione?
The InChIKey is USQGQFICZNKRCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O4/c1-6(14)4-9(7(2)15)13-10(16)5-8(12-3)11(13)17/h5,9,12,16-17H,4H2,1-3H3.
What are the key properties of 3-[2,5-dihydroxy-3-(methylamino)pyrrol-1-yl]hexane-2,5-dione?
3-[2,5-dihydroxy-3-(methylamino)pyrrol-1-yl]hexane-2,5-dione has a molecular weight of 240.26 g/mol, XLogP of 1.05, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2,5-dihydroxy-3-(methylamino)pyrrol-1-yl]hexane-2,5-dione is sourced from PubChem (CID 90873962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).