C34H25F12N3O3 — CID 90874100
[(3R,7R,8aS)-2-[3,5-bis(trifluoromethyl)benzoyl]-3-(1H-indol-3-ylmethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-yl] 3,5-bis(trifluoromethyl)benzoate (PubChem CID 90874100) has the molecular formula C34H25F12N3O3 and a molecular weight of 751.57 g/mol. Its IUPAC name is [(3R,7R,8aS)-2-[3,5-bis(trifluoromethyl)benzoyl]-3-(1H-indol-3-ylmethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-yl] 3,5-bis(trifluoromethyl)benzoate.
| Compound Name | [(3R,7R,8aS)-2-[3,5-bis(trifluoromethyl)benzoyl]-3-(1H-indol-3-ylmethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-yl] 3,5-bis(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 90874100 |
| Molecular Formula | C34H25F12N3O3 |
| Molecular Weight | 751.57 g/mol |
| Exact Mass | 751.17 |
| IUPAC Name | [(3R,7R,8aS)-2-[3,5-bis(trifluoromethyl)benzoyl]-3-(1H-indol-3-ylmethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-yl] 3,5-bis(trifluoromethyl)benzoate |
| SMILES | O=C(O[C@@H]1C[C@H]2CN(C(=O)c3cc(C(F)(F)F)cc(C(F)(F)F)c3)[C@H](Cc3c[nH]c4ccccc34)CN2C1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C34H25F12N3O3/c35-31(36,37)20-5-17(6-21(10-20)32(38,39)40)29(50)49-15-24-12-26(16-48(24)14-25(49)9-19-13-47-28-4-2-1-3-27(19)28)52-30(51)18-7-22(33(41,42)43)11-23(8-18)34(44,45)46/h1-8,10-11,13,24-26,47H,9,12,14-16H2/t24-,25+,26+/m0/s1 |
| InChIKey | CUXHJRCBBKPXJV-JIMJEQGWSA-N |
| XLogP | 8.61 |
| TPSA | 65.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.57 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |