C12H26O6 — CID 90874166
2,2-dimethoxypropane;(1R)-1-[(2S,3R,4S)-3-hydroxy-4-methyloxolan-2-yl]ethane-1,2-diol (PubChem CID 90874166) has the molecular formula C12H26O6 and a molecular weight of 266.33 g/mol. Its IUPAC name is 2,2-dimethoxypropane;(1R)-1-[(2S,3R,4S)-3-hydroxy-4-methyloxolan-2-yl]ethane-1,2-diol.
| Compound Name | 2,2-dimethoxypropane;(1R)-1-[(2S,3R,4S)-3-hydroxy-4-methyloxolan-2-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 90874166 |
| Molecular Formula | C12H26O6 |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 2,2-dimethoxypropane;(1R)-1-[(2S,3R,4S)-3-hydroxy-4-methyloxolan-2-yl]ethane-1,2-diol |
| SMILES | COC(C)(C)OC.C[C@H]1CO[C@H]([C@H](O)CO)[C@@H]1O |
| InChI | InChI=1S/C7H14O4.C5H12O2/c1-4-3-11-7(6(4)10)5(9)2-8;1-5(2,6-3)7-4/h4-10H,2-3H2,1H3;1-4H3/t4-,5+,6+,7+;/m0./s1 |
| InChIKey | MGQYAVMOJIHJIP-LJTMIZJLSA-N |
| XLogP | -0.25 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|