C34H43NO3S — CID 90874268
4-[3-(2,2-dimethylpropylidene)-6-propan-2-ylxanthen-9-yl]-N-heptylbenzenesulfonamide (PubChem CID 90874268) has the molecular formula C34H43NO3S and a molecular weight of 545.79 g/mol. Its IUPAC name is 4-[3-(2,2-dimethylpropylidene)-6-propan-2-ylxanthen-9-yl]-N-heptylbenzenesulfonamide.
| Compound Name | 4-[3-(2,2-dimethylpropylidene)-6-propan-2-ylxanthen-9-yl]-N-heptylbenzenesulfonamide |
|---|---|
| PubChem CID | 90874268 |
| Molecular Formula | C34H43NO3S |
| Molecular Weight | 545.79 g/mol |
| Exact Mass | 545.30 |
| IUPAC Name | 4-[3-(2,2-dimethylpropylidene)-6-propan-2-ylxanthen-9-yl]-N-heptylbenzenesulfonamide |
| SMILES | CCCCCCCNS(=O)(=O)c1ccc(C2=c3ccc(=CC(C)(C)C)cc3Oc3cc(C(C)C)ccc32)cc1 |
| InChI | InChI=1S/C34H43NO3S/c1-7-8-9-10-11-20-35-39(36,37)28-16-13-26(14-17-28)33-29-18-12-25(23-34(4,5)6)21-31(29)38-32-22-27(24(2)3)15-19-30(32)33/h12-19,21-24,35H,7-11,20H2,1-6H3 |
| InChIKey | PASUQJFRJUPCIW-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.79 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|