C19H32BN3O4 — CID 90874318
butyl 4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]piperidine-1-carboxylate (PubChem CID 90874318) has the molecular formula C19H32BN3O4 and a molecular weight of 377.29 g/mol. Its IUPAC name is butyl 4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]piperidine-1-carboxylate.
| Compound Name | butyl 4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 90874318 |
| Molecular Formula | C19H32BN3O4 |
| Molecular Weight | 377.29 g/mol |
| Exact Mass | 377.25 |
| IUPAC Name | butyl 4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]piperidine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CCC(n2cc(B3OC(C)(C)C(C)(C)O3)cn2)CC1 |
| InChI | InChI=1S/C19H32BN3O4/c1-6-7-12-25-17(24)22-10-8-16(9-11-22)23-14-15(13-21-23)20-26-18(2,3)19(4,5)27-20/h13-14,16H,6-12H2,1-5H3 |
| InChIKey | IPWLRFFWPMMGQZ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 65.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.29 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|