About ethane;3-methylidene-[1,3]thiazolo[3,4-a]pyridine
ethane;3-methylidene-[1,3]thiazolo[3,4-a]pyridine (PubChem CID 90874926) has the molecular formula C10H13NS
and a molecular weight of 179.29 g/mol. Its IUPAC name is ethane;3-methylidene-[1,3]thiazolo[3,4-a]pyridine.
Molecular Properties
| Compound Name | ethane;3-methylidene-[1,3]thiazolo[3,4-a]pyridine |
| PubChem CID | 90874926 |
| Molecular Formula | C10H13NS |
| Molecular Weight | 179.29 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | ethane;3-methylidene-[1,3]thiazolo[3,4-a]pyridine |
| SMILES | C=C1SC=C2C=CC=CN12.CC |
| InChI | InChI=1S/C8H7NS.C2H6/c1-7-9-5-3-2-4-8(9)6-10-7;1-2/h2-6H,1H2;1-2H3 |
| InChIKey | GMQVXDRECNCDMO-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.29 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;3-methylidene-[1,3]thiazolo[3,4-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-methylidene-[1,3]thiazolo[3,4-a]pyridine?
The IUPAC name of ethane;3-methylidene-[1,3]thiazolo[3,4-a]pyridine (CID 90874926) is ethane;3-methylidene-[1,3]thiazolo[3,4-a]pyridine.
What is the SMILES notation for ethane;3-methylidene-[1,3]thiazolo[3,4-a]pyridine?
The canonical SMILES for ethane;3-methylidene-[1,3]thiazolo[3,4-a]pyridine is C=C1SC=C2C=CC=CN12.CC.
What is the InChIKey of ethane;3-methylidene-[1,3]thiazolo[3,4-a]pyridine?
The InChIKey is GMQVXDRECNCDMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NS.C2H6/c1-7-9-5-3-2-4-8(9)6-10-7;1-2/h2-6H,1H2;1-2H3.
What are the key properties of ethane;3-methylidene-[1,3]thiazolo[3,4-a]pyridine?
ethane;3-methylidene-[1,3]thiazolo[3,4-a]pyridine has a molecular weight of 179.29 g/mol, XLogP of 3.46, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-methylidene-[1,3]thiazolo[3,4-a]pyridine is sourced from PubChem (CID 90874926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).