C31H32ClFN6O2 — CID 90875453
3-[3-chloro-5-[4-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-3-(2-methylpropyl)anilino]phenyl]phenol (PubChem CID 90875453) has the molecular formula C31H32ClFN6O2 and a molecular weight of 575.09 g/mol. Its IUPAC name is 3-[3-chloro-5-[4-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-3-(2-methylpropyl)anilino]phenyl]phenol.
| Compound Name | 3-[3-chloro-5-[4-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-3-(2-methylpropyl)anilino]phenyl]phenol |
|---|---|
| PubChem CID | 90875453 |
| Molecular Formula | C31H32ClFN6O2 |
| Molecular Weight | 575.09 g/mol |
| Exact Mass | 574.23 |
| IUPAC Name | 3-[3-chloro-5-[4-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-3-(2-methylpropyl)anilino]phenyl]phenol |
| SMILES | CC(C)Cc1cc(Nc2cc(Cl)cc(-c3cccc(O)c3)c2)ccc1C/N=N/c1ncc(F)c(N2CCOCC2)n1 |
| InChI | InChI=1S/C31H32ClFN6O2/c1-20(2)12-23-14-26(36-27-15-24(13-25(32)17-27)21-4-3-5-28(40)16-21)7-6-22(23)18-35-38-31-34-19-29(33)30(37-31)39-8-10-41-11-9-39/h3-7,13-17,19-20,36,40H,8-12,18H2,1-2H3/b38-35+ |
| InChIKey | CBXAIIZBRLZKFP-OBEQGSJMSA-N |
| XLogP | 7.70 |
| TPSA | 95.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.09 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|