C32H58O13 — CID 90875905
[(3S,4S,5S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl] 5-hydroxy-2-(1-hydroxyoctyl)-3-oxo-12-[(3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]dodecanoate (PubChem CID 90875905) has the molecular formula C32H58O13 and a molecular weight of 650.80 g/mol. Its IUPAC name is [(3S,4S,5S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl] 5-hydroxy-2-(1-hydroxyoctyl)-3-oxo-12-[(3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]dodecanoate.
| Compound Name | [(3S,4S,5S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl] 5-hydroxy-2-(1-hydroxyoctyl)-3-oxo-12-[(3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]dodecanoate |
|---|---|
| PubChem CID | 90875905 |
| Molecular Formula | C32H58O13 |
| Molecular Weight | 650.80 g/mol |
| Exact Mass | 650.39 |
| IUPAC Name | [(3S,4S,5S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl] 5-hydroxy-2-(1-hydroxyoctyl)-3-oxo-12-[(3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]dodecanoate |
| SMILES | CCCCCCCC(O)C(C(=O)CC(O)CCCCCCCC1O[C@@H](C)[C@H](O)[C@@H](O)[C@H]1O)C(=O)OC1O[C@H](C)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C32H58O13/c1-4-5-6-8-12-15-21(34)24(31(42)45-32-30(41)29(40)26(37)19(3)44-32)22(35)17-20(33)14-11-9-7-10-13-16-23-27(38)28(39)25(36)18(2)43-23/h18-21,23-30,32-34,36-41H,4-17H2,1-3H3/t18-,19+,20?,21?,23?,24?,25-,26+,27-,28+,29-,30-,32?/m0/s1 |
| InChIKey | UBSCMMVTAKRKLA-RHQYFZNPSA-N |
| XLogP | 0.62 |
| TPSA | 223.67 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.80 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|