C15H20N2O4 — CID 90875925
2-amino-6-(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)hexanoic acid (PubChem CID 90875925) has the molecular formula C15H20N2O4 and a molecular weight of 292.34 g/mol. Its IUPAC name is 2-amino-6-(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)hexanoic acid.
| Compound Name | 2-amino-6-(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)hexanoic acid |
|---|---|
| PubChem CID | 90875925 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 2-amino-6-(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)hexanoic acid |
| SMILES | NC(CCCCn1c(O)c2c(c1O)C1C=CC2C1)C(=O)O |
| InChI | InChI=1S/C15H20N2O4/c16-10(15(20)21)3-1-2-6-17-13(18)11-8-4-5-9(7-8)12(11)14(17)19/h4-5,8-10,18-19H,1-3,6-7,16H2,(H,20,21) |
| InChIKey | YYQBYQTWNCVZOT-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 108.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|