About 2-(1,2-dimethylcyclobutyl)-1-ethylbicyclo[1.1.0]butane
2-(1,2-dimethylcyclobutyl)-1-ethylbicyclo[1.1.0]butane (PubChem CID 90876004) has the molecular formula C12H20
and a molecular weight of 164.29 g/mol. Its IUPAC name is 2-(1,2-dimethylcyclobutyl)-1-ethylbicyclo[1.1.0]butane.
Analyze 2-(1,2-dimethylcyclobutyl)-1-ethylbicyclo[1.1.0]butane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,2-dimethylcyclobutyl)-1-ethylbicyclo[1.1.0]butane?
The IUPAC name of 2-(1,2-dimethylcyclobutyl)-1-ethylbicyclo[1.1.0]butane (CID 90876004) is 2-(1,2-dimethylcyclobutyl)-1-ethylbicyclo[1.1.0]butane.
What is the SMILES notation for 2-(1,2-dimethylcyclobutyl)-1-ethylbicyclo[1.1.0]butane?
The canonical SMILES for 2-(1,2-dimethylcyclobutyl)-1-ethylbicyclo[1.1.0]butane is CCC12CC1C2C1(C)CCC1C.
What is the InChIKey of 2-(1,2-dimethylcyclobutyl)-1-ethylbicyclo[1.1.0]butane?
The InChIKey is IJQQWWJSBYFFKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20/c1-4-12-7-9(12)10(12)11(3)6-5-8(11)2/h8-10H,4-7H2,1-3H3.
What are the key properties of 2-(1,2-dimethylcyclobutyl)-1-ethylbicyclo[1.1.0]butane?
2-(1,2-dimethylcyclobutyl)-1-ethylbicyclo[1.1.0]butane has a molecular weight of 164.29 g/mol, XLogP of 3.47, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,2-dimethylcyclobutyl)-1-ethylbicyclo[1.1.0]butane is sourced from PubChem (CID 90876004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).