C20H17ClN2O3 — CID 90876175
7-N-[1-(4-chlorophenyl)ethyl]-2-N-hydroxynaphthalene-2,7-dicarboxamide (PubChem CID 90876175) has the molecular formula C20H17ClN2O3 and a molecular weight of 368.82 g/mol. Its IUPAC name is 7-N-[1-(4-chlorophenyl)ethyl]-2-N-hydroxynaphthalene-2,7-dicarboxamide.
| Compound Name | 7-N-[1-(4-chlorophenyl)ethyl]-2-N-hydroxynaphthalene-2,7-dicarboxamide |
|---|---|
| PubChem CID | 90876175 |
| Molecular Formula | C20H17ClN2O3 |
| Molecular Weight | 368.82 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 7-N-[1-(4-chlorophenyl)ethyl]-2-N-hydroxynaphthalene-2,7-dicarboxamide |
| SMILES | CC(NC(=O)c1ccc2ccc(C(=O)NO)cc2c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H17ClN2O3/c1-12(13-6-8-18(21)9-7-13)22-19(24)15-4-2-14-3-5-16(20(25)23-26)11-17(14)10-15/h2-12,26H,1H3,(H,22,24)(H,23,25) |
| InChIKey | UHRFPWATCJVNPJ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.82 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|