C28H41N3O5 — CID 90876252
3-[(1-amino-3-cyclohexylpropan-2-yl)amino]-4-[2-[[3-(1-methoxypropoxy)phenyl]methyl]morpholin-4-yl]cyclobut-3-ene-1,2-dione (PubChem CID 90876252) has the molecular formula C28H41N3O5 and a molecular weight of 499.65 g/mol. Its IUPAC name is 3-[(1-amino-3-cyclohexylpropan-2-yl)amino]-4-[2-[[3-(1-methoxypropoxy)phenyl]methyl]morpholin-4-yl]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[(1-amino-3-cyclohexylpropan-2-yl)amino]-4-[2-[[3-(1-methoxypropoxy)phenyl]methyl]morpholin-4-yl]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 90876252 |
| Molecular Formula | C28H41N3O5 |
| Molecular Weight | 499.65 g/mol |
| Exact Mass | 499.30 |
| IUPAC Name | 3-[(1-amino-3-cyclohexylpropan-2-yl)amino]-4-[2-[[3-(1-methoxypropoxy)phenyl]methyl]morpholin-4-yl]cyclobut-3-ene-1,2-dione |
| SMILES | CCC(OC)Oc1cccc(CC2CN(c3c(NC(CN)CC4CCCCC4)c(=O)c3=O)CCO2)c1 |
| InChI | InChI=1S/C28H41N3O5/c1-3-24(34-2)36-22-11-7-10-20(15-22)16-23-18-31(12-13-35-23)26-25(27(32)28(26)33)30-21(17-29)14-19-8-5-4-6-9-19/h7,10-11,15,19,21,23-24,30H,3-6,8-9,12-14,16-18,29H2,1-2H3 |
| InChIKey | GKHGVSLUDOFHJE-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 103.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.65 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|