About 1-[2-(3,3-dimethylbutoxy)-2-methylpropyl]-2-(4-methylhexan-3-yl)hydrazine
1-[2-(3,3-dimethylbutoxy)-2-methylpropyl]-2-(4-methylhexan-3-yl)hydrazine (PubChem CID 90876291) has the molecular formula C17H38N2O
and a molecular weight of 286.50 g/mol. Its IUPAC name is 1-[2-(3,3-dimethylbutoxy)-2-methylpropyl]-2-(4-methylhexan-3-yl)hydrazine.
Molecular Properties
| Compound Name | 1-[2-(3,3-dimethylbutoxy)-2-methylpropyl]-2-(4-methylhexan-3-yl)hydrazine |
| PubChem CID | 90876291 |
| Molecular Formula | C17H38N2O |
| Molecular Weight | 286.50 g/mol |
| Exact Mass | 286.30 |
| IUPAC Name | 1-[2-(3,3-dimethylbutoxy)-2-methylpropyl]-2-(4-methylhexan-3-yl)hydrazine |
| SMILES | CCC(C)C(CC)NNCC(C)(C)OCCC(C)(C)C |
| InChI | InChI=1S/C17H38N2O/c1-9-14(3)15(10-2)19-18-13-17(7,8)20-12-11-16(4,5)6/h14-15,18-19H,9-13H2,1-8H3 |
| InChIKey | AUXDWKGKPXXJMK-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.50 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(3,3-dimethylbutoxy)-2-methylpropyl]-2-(4-methylhexan-3-yl)hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(3,3-dimethylbutoxy)-2-methylpropyl]-2-(4-methylhexan-3-yl)hydrazine?
The IUPAC name of 1-[2-(3,3-dimethylbutoxy)-2-methylpropyl]-2-(4-methylhexan-3-yl)hydrazine (CID 90876291) is 1-[2-(3,3-dimethylbutoxy)-2-methylpropyl]-2-(4-methylhexan-3-yl)hydrazine.
What is the SMILES notation for 1-[2-(3,3-dimethylbutoxy)-2-methylpropyl]-2-(4-methylhexan-3-yl)hydrazine?
The canonical SMILES for 1-[2-(3,3-dimethylbutoxy)-2-methylpropyl]-2-(4-methylhexan-3-yl)hydrazine is CCC(C)C(CC)NNCC(C)(C)OCCC(C)(C)C.
What is the InChIKey of 1-[2-(3,3-dimethylbutoxy)-2-methylpropyl]-2-(4-methylhexan-3-yl)hydrazine?
The InChIKey is AUXDWKGKPXXJMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H38N2O/c1-9-14(3)15(10-2)19-18-13-17(7,8)20-12-11-16(4,5)6/h14-15,18-19H,9-13H2,1-8H3.
What are the key properties of 1-[2-(3,3-dimethylbutoxy)-2-methylpropyl]-2-(4-methylhexan-3-yl)hydrazine?
1-[2-(3,3-dimethylbutoxy)-2-methylpropyl]-2-(4-methylhexan-3-yl)hydrazine has a molecular weight of 286.50 g/mol, XLogP of 4.14, 10 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(3,3-dimethylbutoxy)-2-methylpropyl]-2-(4-methylhexan-3-yl)hydrazine is sourced from PubChem (CID 90876291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).