C22H19ClN2O3 — CID 90876321
2-[1-(3-chloro-4-cyano-2-methylphenyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]pyrrol-4-yl]benzoic acid (PubChem CID 90876321) has the molecular formula C22H19ClN2O3 and a molecular weight of 394.86 g/mol. Its IUPAC name is 2-[1-(3-chloro-4-cyano-2-methylphenyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]pyrrol-4-yl]benzoic acid.
| Compound Name | 2-[1-(3-chloro-4-cyano-2-methylphenyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]pyrrol-4-yl]benzoic acid |
|---|---|
| PubChem CID | 90876321 |
| Molecular Formula | C22H19ClN2O3 |
| Molecular Weight | 394.86 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | 2-[1-(3-chloro-4-cyano-2-methylphenyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]pyrrol-4-yl]benzoic acid |
| SMILES | Cc1c(N2C(=O)CC3C(c4ccccc4C(=O)O)CCC32)ccc(C#N)c1Cl |
| InChI | InChI=1S/C22H19ClN2O3/c1-12-18(8-6-13(11-24)21(12)23)25-19-9-7-15(17(19)10-20(25)26)14-4-2-3-5-16(14)22(27)28/h2-6,8,15,17,19H,7,9-10H2,1H3,(H,27,28) |
| InChIKey | ZDSUWCIXTSYOCA-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.86 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |