C26H31F3O5S — CID 90876562
[4-[4-(4,4,4-trifluorobutyl)phenyl]phenyl]sulfonyl 2-tert-butyloxane-4-carboxylate (PubChem CID 90876562) has the molecular formula C26H31F3O5S and a molecular weight of 512.59 g/mol. Its IUPAC name is [4-[4-(4,4,4-trifluorobutyl)phenyl]phenyl]sulfonyl 2-tert-butyloxane-4-carboxylate.
| Compound Name | [4-[4-(4,4,4-trifluorobutyl)phenyl]phenyl]sulfonyl 2-tert-butyloxane-4-carboxylate |
|---|---|
| PubChem CID | 90876562 |
| Molecular Formula | C26H31F3O5S |
| Molecular Weight | 512.59 g/mol |
| Exact Mass | 512.18 |
| IUPAC Name | [4-[4-(4,4,4-trifluorobutyl)phenyl]phenyl]sulfonyl 2-tert-butyloxane-4-carboxylate |
| SMILES | CC(C)(C)C1CC(C(=O)OS(=O)(=O)c2ccc(-c3ccc(CCCC(F)(F)F)cc3)cc2)CCO1 |
| InChI | InChI=1S/C26H31F3O5S/c1-25(2,3)23-17-21(14-16-33-23)24(30)34-35(31,32)22-12-10-20(11-13-22)19-8-6-18(7-9-19)5-4-15-26(27,28)29/h6-13,21,23H,4-5,14-17H2,1-3H3 |
| InChIKey | GPYLVYSLAMCTLB-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.59 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|