About CID 90877038
CID 90877038 (PubChem CID 90877038) has the molecular formula C17H11BFNO
and a molecular weight of 275.09 g/mol.
Molecular Properties
| Compound Name | CID 90877038 |
| PubChem CID | 90877038 |
| Molecular Formula | C17H11BFNO |
| Molecular Weight | 275.09 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | — |
| SMILES | [B]C(=Cc1ccc(F)cc1)Oc1cccc2cccnc12 |
| InChI | InChI=1S/C17H11BFNO/c18-16(11-12-6-8-14(19)9-7-12)21-15-5-1-3-13-4-2-10-20-17(13)15/h1-11H |
| InChIKey | QDYXHHXXTGAECB-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.09 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 90877038 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 90877038?
The IUPAC name of CID 90877038 (CID 90877038) is not available.
What is the SMILES notation for CID 90877038?
The canonical SMILES for CID 90877038 is [B]C(=Cc1ccc(F)cc1)Oc1cccc2cccnc12.
What is the InChIKey of CID 90877038?
The InChIKey is QDYXHHXXTGAECB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11BFNO/c18-16(11-12-6-8-14(19)9-7-12)21-15-5-1-3-13-4-2-10-20-17(13)15/h1-11H.
What are the key properties of CID 90877038?
CID 90877038 has a molecular weight of 275.09 g/mol, XLogP of 3.92, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 90877038 is sourced from PubChem (CID 90877038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).