C30H27N3O8S — CID 90877122
(4aR,5S,5aR,6R,12aS)-5,10,12a-trihydroxy-6-methyl-9-[(5-methyl-4-phenyl-1,3-thiazol-2-yl)amino]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 90877122) has the molecular formula C30H27N3O8S and a molecular weight of 589.63 g/mol. Its IUPAC name is (4aR,5S,5aR,6R,12aS)-5,10,12a-trihydroxy-6-methyl-9-[(5-methyl-4-phenyl-1,3-thiazol-2-yl)amino]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4aR,5S,5aR,6R,12aS)-5,10,12a-trihydroxy-6-methyl-9-[(5-methyl-4-phenyl-1,3-thiazol-2-yl)amino]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 90877122 |
| Molecular Formula | C30H27N3O8S |
| Molecular Weight | 589.63 g/mol |
| Exact Mass | 589.15 |
| IUPAC Name | (4aR,5S,5aR,6R,12aS)-5,10,12a-trihydroxy-6-methyl-9-[(5-methyl-4-phenyl-1,3-thiazol-2-yl)amino]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | Cc1sc(Nc2ccc3c(c2O)C(=O)C2C(=O)[C@]4(O)C(=O)C(C(N)=O)C(=O)C[C@@H]4[C@@H](O)[C@@H]2[C@H]3C)nc1-c1ccccc1 |
| InChI | InChI=1S/C30H27N3O8S/c1-11-14-8-9-16(32-29-33-22(12(2)42-29)13-6-4-3-5-7-13)24(36)19(14)25(37)21-18(11)23(35)15-10-17(34)20(28(31)40)26(38)30(15,41)27(21)39/h3-9,11,15,18,20-21,23,35-36,41H,10H2,1-2H3,(H2,31,40)(H,32,33)/t11-,15+,18+,20?,21?,23+,30+/m0/s1 |
| InChIKey | WPOSDYDZBIKHOH-IYMIFYBPSA-N |
| XLogP | 2.03 |
| TPSA | 196.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.63 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|