About 2-methyl-3-[(1E)-2-(trifluoromethyl)buta-1,3-dienyl]-2H-1,4-benzothiazine
2-methyl-3-[(1E)-2-(trifluoromethyl)buta-1,3-dienyl]-2H-1,4-benzothiazine (PubChem CID 90877226) has the molecular formula C14H12F3NS
and a molecular weight of 283.32 g/mol. Its IUPAC name is 2-methyl-3-[(1E)-2-(trifluoromethyl)buta-1,3-dienyl]-2H-1,4-benzothiazine.
Molecular Properties
| Compound Name | 2-methyl-3-[(1E)-2-(trifluoromethyl)buta-1,3-dienyl]-2H-1,4-benzothiazine |
| PubChem CID | 90877226 |
| Molecular Formula | C14H12F3NS |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 2-methyl-3-[(1E)-2-(trifluoromethyl)buta-1,3-dienyl]-2H-1,4-benzothiazine |
| SMILES | C=C/C(=C\C1=Nc2ccccc2SC1C)C(F)(F)F |
| InChI | InChI=1S/C14H12F3NS/c1-3-10(14(15,16)17)8-12-9(2)19-13-7-5-4-6-11(13)18-12/h3-9H,1H2,2H3/b10-8+ |
| InChIKey | KOOTUHRDINEJMT-CSKARUKUSA-N |
| XLogP | 4.93 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-3-[(1E)-2-(trifluoromethyl)buta-1,3-dienyl]-2H-1,4-benzothiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3-[(1E)-2-(trifluoromethyl)buta-1,3-dienyl]-2H-1,4-benzothiazine?
The IUPAC name of 2-methyl-3-[(1E)-2-(trifluoromethyl)buta-1,3-dienyl]-2H-1,4-benzothiazine (CID 90877226) is 2-methyl-3-[(1E)-2-(trifluoromethyl)buta-1,3-dienyl]-2H-1,4-benzothiazine.
What is the SMILES notation for 2-methyl-3-[(1E)-2-(trifluoromethyl)buta-1,3-dienyl]-2H-1,4-benzothiazine?
The canonical SMILES for 2-methyl-3-[(1E)-2-(trifluoromethyl)buta-1,3-dienyl]-2H-1,4-benzothiazine is C=C/C(=C\C1=Nc2ccccc2SC1C)C(F)(F)F.
What is the InChIKey of 2-methyl-3-[(1E)-2-(trifluoromethyl)buta-1,3-dienyl]-2H-1,4-benzothiazine?
The InChIKey is KOOTUHRDINEJMT-CSKARUKUSA-N. The full InChI is InChI=1S/C14H12F3NS/c1-3-10(14(15,16)17)8-12-9(2)19-13-7-5-4-6-11(13)18-12/h3-9H,1H2,2H3/b10-8+.
What are the key properties of 2-methyl-3-[(1E)-2-(trifluoromethyl)buta-1,3-dienyl]-2H-1,4-benzothiazine?
2-methyl-3-[(1E)-2-(trifluoromethyl)buta-1,3-dienyl]-2H-1,4-benzothiazine has a molecular weight of 283.32 g/mol, XLogP of 4.93, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3-[(1E)-2-(trifluoromethyl)buta-1,3-dienyl]-2H-1,4-benzothiazine is sourced from PubChem (CID 90877226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).