About 1,5,6,7-tetrahydroisoquinoline
1,5,6,7-tetrahydroisoquinoline (PubChem CID 90877689) has the molecular formula C9H11N
and a molecular weight of 133.19 g/mol. Its IUPAC name is 1,5,6,7-tetrahydroisoquinoline.
Molecular Properties
| Compound Name | 1,5,6,7-tetrahydroisoquinoline |
| PubChem CID | 90877689 |
| Molecular Formula | C9H11N |
| Molecular Weight | 133.19 g/mol |
| Exact Mass | 133.09 |
| IUPAC Name | 1,5,6,7-tetrahydroisoquinoline |
| SMILES | C1=NCC2=CCCCC2=C1 |
| InChI | InChI=1S/C9H11N/c1-2-4-9-7-10-6-5-8(9)3-1/h4-6H,1-3,7H2 |
| InChIKey | DRWYBDDCDFNRBQ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.19 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,5,6,7-tetrahydroisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5,6,7-tetrahydroisoquinoline?
The IUPAC name of 1,5,6,7-tetrahydroisoquinoline (CID 90877689) is 1,5,6,7-tetrahydroisoquinoline.
What is the SMILES notation for 1,5,6,7-tetrahydroisoquinoline?
The canonical SMILES for 1,5,6,7-tetrahydroisoquinoline is C1=NCC2=CCCCC2=C1.
What is the InChIKey of 1,5,6,7-tetrahydroisoquinoline?
The InChIKey is DRWYBDDCDFNRBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N/c1-2-4-9-7-10-6-5-8(9)3-1/h4-6H,1-3,7H2.
What are the key properties of 1,5,6,7-tetrahydroisoquinoline?
1,5,6,7-tetrahydroisoquinoline has a molecular weight of 133.19 g/mol, XLogP of 2.11, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5,6,7-tetrahydroisoquinoline is sourced from PubChem (CID 90877689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).