C9H11NS — CID 90877822
2,5,5a,9a-tetrahydro-1,4-benzothiazepine (PubChem CID 90877822) has the molecular formula C9H11NS and a molecular weight of 165.26 g/mol. Its IUPAC name is 2,5,5a,9a-tetrahydro-1,4-benzothiazepine.
| Compound Name | 2,5,5a,9a-tetrahydro-1,4-benzothiazepine |
|---|---|
| PubChem CID | 90877822 |
| Molecular Formula | C9H11NS |
| Molecular Weight | 165.26 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | 2,5,5a,9a-tetrahydro-1,4-benzothiazepine |
| SMILES | C1=CC2CN=CCSC2C=C1 |
| InChI | InChI=1S/C9H11NS/c1-2-4-9-8(3-1)7-10-5-6-11-9/h1-5,8-9H,6-7H2 |
| InChIKey | GGXFNBPYZPEPSR-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.26 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |