About (2R)-2-(oxan-4-ylmethyl)-1,3-thiazolidine-3,4-dicarboxylic acid
(2R)-2-(oxan-4-ylmethyl)-1,3-thiazolidine-3,4-dicarboxylic acid (PubChem CID 90878126) has the molecular formula C11H17NO5S
and a molecular weight of 275.33 g/mol. Its IUPAC name is (2R)-2-(oxan-4-ylmethyl)-1,3-thiazolidine-3,4-dicarboxylic acid.
Molecular Properties
| Compound Name | (2R)-2-(oxan-4-ylmethyl)-1,3-thiazolidine-3,4-dicarboxylic acid |
| PubChem CID | 90878126 |
| Molecular Formula | C11H17NO5S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | (2R)-2-(oxan-4-ylmethyl)-1,3-thiazolidine-3,4-dicarboxylic acid |
| SMILES | O=C(O)C1CS[C@H](CC2CCOCC2)N1C(=O)O |
| InChI | InChI=1S/C11H17NO5S/c13-10(14)8-6-18-9(12(8)11(15)16)5-7-1-3-17-4-2-7/h7-9H,1-6H2,(H,13,14)(H,15,16)/t8?,9-/m1/s1 |
| InChIKey | NJOMNASIMKFZNZ-YGPZHTELSA-N |
| XLogP | 1.31 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R)-2-(oxan-4-ylmethyl)-1,3-thiazolidine-3,4-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-(oxan-4-ylmethyl)-1,3-thiazolidine-3,4-dicarboxylic acid?
The IUPAC name of (2R)-2-(oxan-4-ylmethyl)-1,3-thiazolidine-3,4-dicarboxylic acid (CID 90878126) is (2R)-2-(oxan-4-ylmethyl)-1,3-thiazolidine-3,4-dicarboxylic acid.
What is the SMILES notation for (2R)-2-(oxan-4-ylmethyl)-1,3-thiazolidine-3,4-dicarboxylic acid?
The canonical SMILES for (2R)-2-(oxan-4-ylmethyl)-1,3-thiazolidine-3,4-dicarboxylic acid is O=C(O)C1CS[C@H](CC2CCOCC2)N1C(=O)O.
What is the InChIKey of (2R)-2-(oxan-4-ylmethyl)-1,3-thiazolidine-3,4-dicarboxylic acid?
The InChIKey is NJOMNASIMKFZNZ-YGPZHTELSA-N. The full InChI is InChI=1S/C11H17NO5S/c13-10(14)8-6-18-9(12(8)11(15)16)5-7-1-3-17-4-2-7/h7-9H,1-6H2,(H,13,14)(H,15,16)/t8?,9-/m1/s1.
What are the key properties of (2R)-2-(oxan-4-ylmethyl)-1,3-thiazolidine-3,4-dicarboxylic acid?
(2R)-2-(oxan-4-ylmethyl)-1,3-thiazolidine-3,4-dicarboxylic acid has a molecular weight of 275.33 g/mol, XLogP of 1.31, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(oxan-4-ylmethyl)-1,3-thiazolidine-3,4-dicarboxylic acid is sourced from PubChem (CID 90878126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).