C18H15F3N2 — CID 90878171
2-[2-[2-phenyl-4-(trifluoromethyl)phenyl]ethyl]-1H-imidazole (PubChem CID 90878171) has the molecular formula C18H15F3N2 and a molecular weight of 316.33 g/mol. Its IUPAC name is 2-[2-[2-phenyl-4-(trifluoromethyl)phenyl]ethyl]-1H-imidazole.
| Compound Name | 2-[2-[2-phenyl-4-(trifluoromethyl)phenyl]ethyl]-1H-imidazole |
|---|---|
| PubChem CID | 90878171 |
| Molecular Formula | C18H15F3N2 |
| Molecular Weight | 316.33 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 2-[2-[2-phenyl-4-(trifluoromethyl)phenyl]ethyl]-1H-imidazole |
| SMILES | FC(F)(F)c1ccc(CCc2ncc[nH]2)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C18H15F3N2/c19-18(20,21)15-8-6-14(7-9-17-22-10-11-23-17)16(12-15)13-4-2-1-3-5-13/h1-6,8,10-12H,7,9H2,(H,22,23) |
| InChIKey | CHEUUAGYXDXJPI-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.33 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |