About 2,3-bis(1,2,2-trifluoroethenoxy)bicyclo[2.2.1]heptane;ethane
2,3-bis(1,2,2-trifluoroethenoxy)bicyclo[2.2.1]heptane;ethane (PubChem CID 90878323) has the molecular formula C13H16F6O2
and a molecular weight of 318.26 g/mol. Its IUPAC name is 2,3-bis(1,2,2-trifluoroethenoxy)bicyclo[2.2.1]heptane;ethane.
Molecular Properties
| Compound Name | 2,3-bis(1,2,2-trifluoroethenoxy)bicyclo[2.2.1]heptane;ethane |
| PubChem CID | 90878323 |
| Molecular Formula | C13H16F6O2 |
| Molecular Weight | 318.26 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 2,3-bis(1,2,2-trifluoroethenoxy)bicyclo[2.2.1]heptane;ethane |
| SMILES | CC.FC(F)=C(F)OC1C2CCC(C2)C1OC(F)=C(F)F |
| InChI | InChI=1S/C11H10F6O2.C2H6/c12-8(13)10(16)18-6-4-1-2-5(3-4)7(6)19-11(17)9(14)15;1-2/h4-7H,1-3H2;1-2H3 |
| InChIKey | DTBCUBCLHJZABH-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 318.26 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 2,3-bis(1,2,2-trifluoroethenoxy)bicyclo[2.2.1]heptane;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-bis(1,2,2-trifluoroethenoxy)bicyclo[2.2.1]heptane;ethane?
The IUPAC name of 2,3-bis(1,2,2-trifluoroethenoxy)bicyclo[2.2.1]heptane;ethane (CID 90878323) is 2,3-bis(1,2,2-trifluoroethenoxy)bicyclo[2.2.1]heptane;ethane.
What is the SMILES notation for 2,3-bis(1,2,2-trifluoroethenoxy)bicyclo[2.2.1]heptane;ethane?
The canonical SMILES for 2,3-bis(1,2,2-trifluoroethenoxy)bicyclo[2.2.1]heptane;ethane is CC.FC(F)=C(F)OC1C2CCC(C2)C1OC(F)=C(F)F.
What is the InChIKey of 2,3-bis(1,2,2-trifluoroethenoxy)bicyclo[2.2.1]heptane;ethane?
The InChIKey is DTBCUBCLHJZABH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10F6O2.C2H6/c12-8(13)10(16)18-6-4-1-2-5(3-4)7(6)19-11(17)9(14)15;1-2/h4-7H,1-3H2;1-2H3.
What are the key properties of 2,3-bis(1,2,2-trifluoroethenoxy)bicyclo[2.2.1]heptane;ethane?
2,3-bis(1,2,2-trifluoroethenoxy)bicyclo[2.2.1]heptane;ethane has a molecular weight of 318.26 g/mol, XLogP of 5.28, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-bis(1,2,2-trifluoroethenoxy)bicyclo[2.2.1]heptane;ethane is sourced from PubChem (CID 90878323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).