About 1-(6-methyl-2,3,4,5-tetrahydropyridin-2-yl)propan-2-one
1-(6-methyl-2,3,4,5-tetrahydropyridin-2-yl)propan-2-one (PubChem CID 90878365) has the molecular formula C9H15NO
and a molecular weight of 153.22 g/mol. Its IUPAC name is 1-(6-methyl-2,3,4,5-tetrahydropyridin-2-yl)propan-2-one.
Analyze 1-(6-methyl-2,3,4,5-tetrahydropyridin-2-yl)propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-methyl-2,3,4,5-tetrahydropyridin-2-yl)propan-2-one?
The IUPAC name of 1-(6-methyl-2,3,4,5-tetrahydropyridin-2-yl)propan-2-one (CID 90878365) is 1-(6-methyl-2,3,4,5-tetrahydropyridin-2-yl)propan-2-one.
What is the SMILES notation for 1-(6-methyl-2,3,4,5-tetrahydropyridin-2-yl)propan-2-one?
The canonical SMILES for 1-(6-methyl-2,3,4,5-tetrahydropyridin-2-yl)propan-2-one is CC(=O)CC1CCCC(C)=N1.
What is the InChIKey of 1-(6-methyl-2,3,4,5-tetrahydropyridin-2-yl)propan-2-one?
The InChIKey is DAKWFMWLKUCUON-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO/c1-7-4-3-5-9(10-7)6-8(2)11/h9H,3-6H2,1-2H3.
What are the key properties of 1-(6-methyl-2,3,4,5-tetrahydropyridin-2-yl)propan-2-one?
1-(6-methyl-2,3,4,5-tetrahydropyridin-2-yl)propan-2-one has a molecular weight of 153.22 g/mol, XLogP of 1.98, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-methyl-2,3,4,5-tetrahydropyridin-2-yl)propan-2-one is sourced from PubChem (CID 90878365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).