C25H39NO — CID 90878579
(3R,7R,8R,9S,10S,13S,14S)-3-[2-(azetidin-3-yl)ethenyl]-7,10,13-trimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one (PubChem CID 90878579) has the molecular formula C25H39NO and a molecular weight of 369.59 g/mol. Its IUPAC name is (3R,7R,8R,9S,10S,13S,14S)-3-[2-(azetidin-3-yl)ethenyl]-7,10,13-trimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one.
| Compound Name | (3R,7R,8R,9S,10S,13S,14S)-3-[2-(azetidin-3-yl)ethenyl]-7,10,13-trimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 90878579 |
| Molecular Formula | C25H39NO |
| Molecular Weight | 369.59 g/mol |
| Exact Mass | 369.30 |
| IUPAC Name | (3R,7R,8R,9S,10S,13S,14S)-3-[2-(azetidin-3-yl)ethenyl]-7,10,13-trimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one |
| SMILES | C[C@@H]1CC2C[C@H](C=CC3CNC3)CC[C@]2(C)[C@H]2CC[C@]3(C)C(=O)CC[C@H]3[C@H]12 |
| InChI | InChI=1S/C25H39NO/c1-16-12-19-13-17(4-5-18-14-26-15-18)8-10-24(19,2)21-9-11-25(3)20(23(16)21)6-7-22(25)27/h4-5,16-21,23,26H,6-15H2,1-3H3/t16-,17-,19?,20+,21+,23+,24+,25+/m1/s1 |
| InChIKey | FQMCNXPTMUDNGN-XRZYBZSMSA-N |
| XLogP | 5.24 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.59 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|