About 5-ethyl-2,9,10-trimethyl-8-methylidene-N-propan-2-ylundecan-4-amine
5-ethyl-2,9,10-trimethyl-8-methylidene-N-propan-2-ylundecan-4-amine (PubChem CID 90878934) has the molecular formula C20H41N
and a molecular weight of 295.56 g/mol. Its IUPAC name is 5-ethyl-2,9,10-trimethyl-8-methylidene-N-propan-2-ylundecan-4-amine.
Molecular Properties
| Compound Name | 5-ethyl-2,9,10-trimethyl-8-methylidene-N-propan-2-ylundecan-4-amine |
| PubChem CID | 90878934 |
| Molecular Formula | C20H41N |
| Molecular Weight | 295.56 g/mol |
| Exact Mass | 295.32 |
| IUPAC Name | 5-ethyl-2,9,10-trimethyl-8-methylidene-N-propan-2-ylundecan-4-amine |
| SMILES | C=C(CCC(CC)C(CC(C)C)NC(C)C)C(C)C(C)C |
| InChI | InChI=1S/C20H41N/c1-10-19(12-11-17(8)18(9)15(4)5)20(13-14(2)3)21-16(6)7/h14-16,18-21H,8,10-13H2,1-7,9H3 |
| InChIKey | BPHYAPQTDMIKDV-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 295.56 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-ethyl-2,9,10-trimethyl-8-methylidene-N-propan-2-ylundecan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-2,9,10-trimethyl-8-methylidene-N-propan-2-ylundecan-4-amine?
The IUPAC name of 5-ethyl-2,9,10-trimethyl-8-methylidene-N-propan-2-ylundecan-4-amine (CID 90878934) is 5-ethyl-2,9,10-trimethyl-8-methylidene-N-propan-2-ylundecan-4-amine.
What is the SMILES notation for 5-ethyl-2,9,10-trimethyl-8-methylidene-N-propan-2-ylundecan-4-amine?
The canonical SMILES for 5-ethyl-2,9,10-trimethyl-8-methylidene-N-propan-2-ylundecan-4-amine is C=C(CCC(CC)C(CC(C)C)NC(C)C)C(C)C(C)C.
What is the InChIKey of 5-ethyl-2,9,10-trimethyl-8-methylidene-N-propan-2-ylundecan-4-amine?
The InChIKey is BPHYAPQTDMIKDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H41N/c1-10-19(12-11-17(8)18(9)15(4)5)20(13-14(2)3)21-16(6)7/h14-16,18-21H,8,10-13H2,1-7,9H3.
What are the key properties of 5-ethyl-2,9,10-trimethyl-8-methylidene-N-propan-2-ylundecan-4-amine?
5-ethyl-2,9,10-trimethyl-8-methylidene-N-propan-2-ylundecan-4-amine has a molecular weight of 295.56 g/mol, XLogP of 6.05, 11 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-2,9,10-trimethyl-8-methylidene-N-propan-2-ylundecan-4-amine is sourced from PubChem (CID 90878934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).