C46H78N10O9S — CID 90879164
5-isocyanato-3-[4,7,10-tris(2-oxopropyl)-1,4,7,10-tetrazacyclododec-1-yl]pentan-2-one;5-isothiocyanato-3-[4,7,10-tris(2-oxopropyl)-1,4,7,10-tetrazacyclododec-1-yl]pentan-2-one (PubChem CID 90879164) has the molecular formula C46H78N10O9S and a molecular weight of 947.26 g/mol. Its IUPAC name is 5-isocyanato-3-[4,7,10-tris(2-oxopropyl)-1,4,7,10-tetrazacyclododec-1-yl]pentan-2-one;5-isothiocyanato-3-[4,7,10-tris(2-oxopropyl)-1,4,7,10-tetrazacyclododec-1-yl]pentan-2-one.
| Compound Name | 5-isocyanato-3-[4,7,10-tris(2-oxopropyl)-1,4,7,10-tetrazacyclododec-1-yl]pentan-2-one;5-isothiocyanato-3-[4,7,10-tris(2-oxopropyl)-1,4,7,10-tetrazacyclododec-1-yl]pentan-2-one |
|---|---|
| PubChem CID | 90879164 |
| Molecular Formula | C46H78N10O9S |
| Molecular Weight | 947.26 g/mol |
| Exact Mass | 946.57 |
| IUPAC Name | 5-isocyanato-3-[4,7,10-tris(2-oxopropyl)-1,4,7,10-tetrazacyclododec-1-yl]pentan-2-one;5-isothiocyanato-3-[4,7,10-tris(2-oxopropyl)-1,4,7,10-tetrazacyclododec-1-yl]pentan-2-one |
| SMILES | CC(=O)CN1CCN(CC(C)=O)CCN(C(CCN=C=O)C(C)=O)CCN(CC(C)=O)CC1.CC(=O)CN1CCN(CC(C)=O)CCN(C(CCN=C=S)C(C)=O)CCN(CC(C)=O)CC1 |
| InChI | InChI=1S/C23H39N5O5.C23H39N5O4S/c1-19(30)15-25-7-9-26(16-20(2)31)11-13-28(23(22(4)33)5-6-24-18-29)14-12-27(10-8-25)17-21(3)32;1-19(29)15-25-7-9-26(16-20(2)30)11-13-28(23(22(4)32)5-6-24-18-33)14-12-27(10-8-25)17-21(3)31/h2*23H,5-17H2,1-4H3 |
| InChIKey | JCZJKGGFDPYNPN-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 204.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 947.26 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|