About 4-imino-N,N-dimethylhexan-1-amine
4-imino-N,N-dimethylhexan-1-amine (PubChem CID 90879333) has the molecular formula C8H18N2
and a molecular weight of 142.25 g/mol. Its IUPAC name is 4-imino-N,N-dimethylhexan-1-amine.
Molecular Properties
| Compound Name | 4-imino-N,N-dimethylhexan-1-amine |
| PubChem CID | 90879333 |
| Molecular Formula | C8H18N2 |
| Molecular Weight | 142.25 g/mol |
| Exact Mass | 142.15 |
| IUPAC Name | 4-imino-N,N-dimethylhexan-1-amine |
| SMILES | [H]/N=C(\CC)CCCN(C)C |
| InChI | InChI=1S/C8H18N2/c1-4-8(9)6-5-7-10(2)3/h9H,4-7H2,1-3H3/b9-8+ |
| InChIKey | ZVVIJCHPVNOLLG-CMDGGOBGSA-N |
| XLogP | 1.76 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.25 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-imino-N,N-dimethylhexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-imino-N,N-dimethylhexan-1-amine?
The IUPAC name of 4-imino-N,N-dimethylhexan-1-amine (CID 90879333) is 4-imino-N,N-dimethylhexan-1-amine.
What is the SMILES notation for 4-imino-N,N-dimethylhexan-1-amine?
The canonical SMILES for 4-imino-N,N-dimethylhexan-1-amine is [H]/N=C(\CC)CCCN(C)C.
What is the InChIKey of 4-imino-N,N-dimethylhexan-1-amine?
The InChIKey is ZVVIJCHPVNOLLG-CMDGGOBGSA-N. The full InChI is InChI=1S/C8H18N2/c1-4-8(9)6-5-7-10(2)3/h9H,4-7H2,1-3H3/b9-8+.
What are the key properties of 4-imino-N,N-dimethylhexan-1-amine?
4-imino-N,N-dimethylhexan-1-amine has a molecular weight of 142.25 g/mol, XLogP of 1.76, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-imino-N,N-dimethylhexan-1-amine is sourced from PubChem (CID 90879333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).