C34H62O3Si2 — CID 90879503
(2S)-2-[(1R,7aR)-4-[2-[(3S,5R)-3,5-bis[[butyl(dimethyl)silyl]oxy]-2-methylcyclohexen-1-yl]ethenyl]-7a-methyl-1,2,3,3a,6,7-hexahydroinden-1-yl]propan-1-ol (PubChem CID 90879503) has the molecular formula C34H62O3Si2 and a molecular weight of 575.04 g/mol. Its IUPAC name is (2S)-2-[(1R,7aR)-4-[2-[(3S,5R)-3,5-bis[[butyl(dimethyl)silyl]oxy]-2-methylcyclohexen-1-yl]ethenyl]-7a-methyl-1,2,3,3a,6,7-hexahydroinden-1-yl]propan-1-ol.
| Compound Name | (2S)-2-[(1R,7aR)-4-[2-[(3S,5R)-3,5-bis[[butyl(dimethyl)silyl]oxy]-2-methylcyclohexen-1-yl]ethenyl]-7a-methyl-1,2,3,3a,6,7-hexahydroinden-1-yl]propan-1-ol |
|---|---|
| PubChem CID | 90879503 |
| Molecular Formula | C34H62O3Si2 |
| Molecular Weight | 575.04 g/mol |
| Exact Mass | 574.42 |
| IUPAC Name | (2S)-2-[(1R,7aR)-4-[2-[(3S,5R)-3,5-bis[[butyl(dimethyl)silyl]oxy]-2-methylcyclohexen-1-yl]ethenyl]-7a-methyl-1,2,3,3a,6,7-hexahydroinden-1-yl]propan-1-ol |
| SMILES | CCCC[Si](C)(C)O[C@@H]1CC(C=CC2=CCC[C@@]3(C)C2CC[C@@H]3[C@H](C)CO)=C(C)[C@@H](O[Si](C)(C)CCCC)C1 |
| InChI | InChI=1S/C34H62O3Si2/c1-10-12-21-38(6,7)36-30-23-29(27(4)33(24-30)37-39(8,9)22-13-11-2)17-16-28-15-14-20-34(5)31(26(3)25-35)18-19-32(28)34/h15-17,26,30-33,35H,10-14,18-25H2,1-9H3/t26-,30-,31-,32?,33+,34-/m1/s1 |
| InChIKey | PJGVJEJCXUYPOT-OVIGHGJOSA-N |
| XLogP | 9.81 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.04 |
| LogP ≤ 5 | 9.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|