C15H12Cl2N6O3S — CID 90880226
[[1-[(3,4-dichlorophenyl)methyl]-5-methyltriazole-4-carbonyl]amino] 5-methyl-1,3,4-thiadiazole-2-carboxylate (PubChem CID 90880226) has the molecular formula C15H12Cl2N6O3S and a molecular weight of 427.27 g/mol. Its IUPAC name is [[1-[(3,4-dichlorophenyl)methyl]-5-methyltriazole-4-carbonyl]amino] 5-methyl-1,3,4-thiadiazole-2-carboxylate.
| Compound Name | [[1-[(3,4-dichlorophenyl)methyl]-5-methyltriazole-4-carbonyl]amino] 5-methyl-1,3,4-thiadiazole-2-carboxylate |
|---|---|
| PubChem CID | 90880226 |
| Molecular Formula | C15H12Cl2N6O3S |
| Molecular Weight | 427.27 g/mol |
| Exact Mass | 426.01 |
| IUPAC Name | [[1-[(3,4-dichlorophenyl)methyl]-5-methyltriazole-4-carbonyl]amino] 5-methyl-1,3,4-thiadiazole-2-carboxylate |
| SMILES | Cc1nnc(C(=O)ONC(=O)c2nnn(Cc3ccc(Cl)c(Cl)c3)c2C)s1 |
| InChI | InChI=1S/C15H12Cl2N6O3S/c1-7-12(13(24)21-26-15(25)14-20-18-8(2)27-14)19-22-23(7)6-9-3-4-10(16)11(17)5-9/h3-5H,6H2,1-2H3,(H,21,24) |
| InChIKey | HPIQWAURKSVPJC-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 111.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.27 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|