C14H17F3N2O3 — CID 9088080
4-ethyl-N'-[(3R)-4,4,4-trifluoro-3-hydroxy-3-methylbutanoyl]benzohydrazide (PubChem CID 9088080) has the molecular formula C14H17F3N2O3 and a molecular weight of 318.29 g/mol. Its IUPAC name is 4-ethyl-N'-[(3R)-4,4,4-trifluoro-3-hydroxy-3-methylbutanoyl]benzohydrazide.
| Compound Name | 4-ethyl-N'-[(3R)-4,4,4-trifluoro-3-hydroxy-3-methylbutanoyl]benzohydrazide |
|---|---|
| PubChem CID | 9088080 |
| Molecular Formula | C14H17F3N2O3 |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 4-ethyl-N'-[(3R)-4,4,4-trifluoro-3-hydroxy-3-methylbutanoyl]benzohydrazide |
| SMILES | CCc1ccc(C(=O)NNC(=O)C[C@@](C)(O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H17F3N2O3/c1-3-9-4-6-10(7-5-9)12(21)19-18-11(20)8-13(2,22)14(15,16)17/h4-7,22H,3,8H2,1-2H3,(H,18,20)(H,19,21)/t13-/m1/s1 |
| InChIKey | SCBBKRRDBIWZCY-CYBMUJFWSA-N |
| XLogP | 1.71 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|