C20H32O5 — CID 90881072
trans-(4S,5R)-2-butanoyl-4-hydroxy-5-(3-methylbutyl)-4-(4-methylpentanoyl)cyclopentane-1,3-dione (PubChem CID 90881072) has the molecular formula C20H32O5 and a molecular weight of 352.47 g/mol. Its IUPAC name is trans-(4S,5R)-2-butanoyl-4-hydroxy-5-(3-methylbutyl)-4-(4-methylpentanoyl)cyclopentane-1,3-dione.
| Compound Name | trans-(4S,5R)-2-butanoyl-4-hydroxy-5-(3-methylbutyl)-4-(4-methylpentanoyl)cyclopentane-1,3-dione |
|---|---|
| PubChem CID | 90881072 |
| Molecular Formula | C20H32O5 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | trans-(4S,5R)-2-butanoyl-4-hydroxy-5-(3-methylbutyl)-4-(4-methylpentanoyl)cyclopentane-1,3-dione |
| SMILES | CCCC(=O)C1C(=O)[C@H](CCC(C)C)[C@](O)(C(=O)CCC(C)C)C1=O |
| InChI | InChI=1S/C20H32O5/c1-6-7-15(21)17-18(23)14(10-8-12(2)3)20(25,19(17)24)16(22)11-9-13(4)5/h12-14,17,25H,6-11H2,1-5H3/t14-,17?,20-/m0/s1 |
| InChIKey | KZDHTCHXVGLLKQ-GCTQLOCRSA-N |
| XLogP | 2.91 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|