C17H24BrN3O — CID 90881719
1-[2-bromo-6-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]-2,3-dihydroindol-1-yl]ethanone (PubChem CID 90881719) has the molecular formula C17H24BrN3O and a molecular weight of 366.30 g/mol. Its IUPAC name is 1-[2-bromo-6-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]-2,3-dihydroindol-1-yl]ethanone.
| Compound Name | 1-[2-bromo-6-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]-2,3-dihydroindol-1-yl]ethanone |
|---|---|
| PubChem CID | 90881719 |
| Molecular Formula | C17H24BrN3O |
| Molecular Weight | 366.30 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | 1-[2-bromo-6-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]-2,3-dihydroindol-1-yl]ethanone |
| SMILES | CC(=O)N1c2cc(N3C[C@@H](C)N(C)[C@@H](C)C3)ccc2CC1Br |
| InChI | InChI=1S/C17H24BrN3O/c1-11-9-20(10-12(2)19(11)4)15-6-5-14-7-17(18)21(13(3)22)16(14)8-15/h5-6,8,11-12,17H,7,9-10H2,1-4H3/t11-,12+,17? |
| InChIKey | QVTMYCRFKDUFKM-GTKHYJCHSA-N |
| XLogP | 2.85 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.30 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|