C28H25Cl3N4OS2 — CID 90881744
1-[1-(4-chlorophenyl)cyclopropyl]ethyl N-amino-1-(2-chlorophenyl)-5-(4-chlorophenyl)-4-methylsulfinylpyrazole-3-carboximidothioate (PubChem CID 90881744) has the molecular formula C28H25Cl3N4OS2 and a molecular weight of 604.03 g/mol. Its IUPAC name is 1-[1-(4-chlorophenyl)cyclopropyl]ethyl N-amino-1-(2-chlorophenyl)-5-(4-chlorophenyl)-4-methylsulfinylpyrazole-3-carboximidothioate.
| Compound Name | 1-[1-(4-chlorophenyl)cyclopropyl]ethyl N-amino-1-(2-chlorophenyl)-5-(4-chlorophenyl)-4-methylsulfinylpyrazole-3-carboximidothioate |
|---|---|
| PubChem CID | 90881744 |
| Molecular Formula | C28H25Cl3N4OS2 |
| Molecular Weight | 604.03 g/mol |
| Exact Mass | 602.05 |
| IUPAC Name | 1-[1-(4-chlorophenyl)cyclopropyl]ethyl N-amino-1-(2-chlorophenyl)-5-(4-chlorophenyl)-4-methylsulfinylpyrazole-3-carboximidothioate |
| SMILES | CC(SC(=NN)c1nn(-c2ccccc2Cl)c(-c2ccc(Cl)cc2)c1S(C)=O)C1(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C28H25Cl3N4OS2/c1-17(28(15-16-28)19-9-13-21(30)14-10-19)37-27(33-32)24-26(38(2)36)25(18-7-11-20(29)12-8-18)35(34-24)23-6-4-3-5-22(23)31/h3-14,17H,15-16,32H2,1-2H3 |
| InChIKey | BRDXTFPIZIMOML-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 73.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.03 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|