C26H48N2O2 — CID 90881831
1-[4-(2,2,3,3,4-pentamethylpiperidin-1-yl)dodecyl]pyrrole-2,5-diol (PubChem CID 90881831) has the molecular formula C26H48N2O2 and a molecular weight of 420.68 g/mol. Its IUPAC name is 1-[4-(2,2,3,3,4-pentamethylpiperidin-1-yl)dodecyl]pyrrole-2,5-diol.
| Compound Name | 1-[4-(2,2,3,3,4-pentamethylpiperidin-1-yl)dodecyl]pyrrole-2,5-diol |
|---|---|
| PubChem CID | 90881831 |
| Molecular Formula | C26H48N2O2 |
| Molecular Weight | 420.68 g/mol |
| Exact Mass | 420.37 |
| IUPAC Name | 1-[4-(2,2,3,3,4-pentamethylpiperidin-1-yl)dodecyl]pyrrole-2,5-diol |
| SMILES | CCCCCCCCC(CCCn1c(O)ccc1O)N1CCC(C)C(C)(C)C1(C)C |
| InChI | InChI=1S/C26H48N2O2/c1-7-8-9-10-11-12-14-22(15-13-19-27-23(29)16-17-24(27)30)28-20-18-21(2)25(3,4)26(28,5)6/h16-17,21-22,29-30H,7-15,18-20H2,1-6H3 |
| InChIKey | NCAZKSATVIVBQR-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 48.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.68 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|