C23H28N4O14S — CID 90882009
2-(2-amino-1,3-thiazol-4-yl)-N-[4-[2-[[1,1-dihydroxy-2-methoxy-2-(2,3,4,5-tetrahydroxy-6-methylphenyl)ethyl]amino]ethyl]-2,3,5,6-tetrahydroxyphenyl]-2,2-dihydroxyacetamide (PubChem CID 90882009) has the molecular formula C23H28N4O14S and a molecular weight of 616.56 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazol-4-yl)-N-[4-[2-[[1,1-dihydroxy-2-methoxy-2-(2,3,4,5-tetrahydroxy-6-methylphenyl)ethyl]amino]ethyl]-2,3,5,6-tetrahydroxyphenyl]-2,2-dihydroxyacetamide.
| Compound Name | 2-(2-amino-1,3-thiazol-4-yl)-N-[4-[2-[[1,1-dihydroxy-2-methoxy-2-(2,3,4,5-tetrahydroxy-6-methylphenyl)ethyl]amino]ethyl]-2,3,5,6-tetrahydroxyphenyl]-2,2-dihydroxyacetamide |
|---|---|
| PubChem CID | 90882009 |
| Molecular Formula | C23H28N4O14S |
| Molecular Weight | 616.56 g/mol |
| Exact Mass | 616.13 |
| IUPAC Name | 2-(2-amino-1,3-thiazol-4-yl)-N-[4-[2-[[1,1-dihydroxy-2-methoxy-2-(2,3,4,5-tetrahydroxy-6-methylphenyl)ethyl]amino]ethyl]-2,3,5,6-tetrahydroxyphenyl]-2,2-dihydroxyacetamide |
| SMILES | COC(c1c(C)c(O)c(O)c(O)c1O)C(O)(O)NCCc1c(O)c(O)c(NC(=O)C(O)(O)c2csc(N)n2)c(O)c1O |
| InChI | InChI=1S/C23H28N4O14S/c1-6-9(14(31)18(35)17(34)11(6)28)19(41-2)23(39,40)25-4-3-7-12(29)15(32)10(16(33)13(7)30)27-20(36)22(37,38)8-5-42-21(24)26-8/h5,19,25,28-35,37-40H,3-4H2,1-2H3,(H2,24,26)(H,27,36) |
| InChIKey | LCLVDIVCZCCXEG-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 332.03 Ų |
| H-Bond Donors | 15 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.56 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 15 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|