C32H41FN4O — CID 90882560
3-[2-[5-(4-fluorophenyl)imino-6-methanimidoyl-7a-methyl-2,3,6,7-tetrahydro-1H-inden-1-yl]-1-phenylethyl]-1,1-di(propan-2-yl)urea (PubChem CID 90882560) has the molecular formula C32H41FN4O and a molecular weight of 516.71 g/mol. Its IUPAC name is 3-[2-[5-(4-fluorophenyl)imino-6-methanimidoyl-7a-methyl-2,3,6,7-tetrahydro-1H-inden-1-yl]-1-phenylethyl]-1,1-di(propan-2-yl)urea.
| Compound Name | 3-[2-[5-(4-fluorophenyl)imino-6-methanimidoyl-7a-methyl-2,3,6,7-tetrahydro-1H-inden-1-yl]-1-phenylethyl]-1,1-di(propan-2-yl)urea |
|---|---|
| PubChem CID | 90882560 |
| Molecular Formula | C32H41FN4O |
| Molecular Weight | 516.71 g/mol |
| Exact Mass | 516.33 |
| IUPAC Name | 3-[2-[5-(4-fluorophenyl)imino-6-methanimidoyl-7a-methyl-2,3,6,7-tetrahydro-1H-inden-1-yl]-1-phenylethyl]-1,1-di(propan-2-yl)urea |
| SMILES | [H]/N=C/C1CC2(C)C(=C/C1=N\c1ccc(F)cc1)CCC2CC(NC(=O)N(C(C)C)C(C)C)c1ccccc1 |
| InChI | InChI=1S/C32H41FN4O/c1-21(2)37(22(3)4)31(38)36-29(23-9-7-6-8-10-23)17-25-11-12-26-18-30(24(20-34)19-32(25,26)5)35-28-15-13-27(33)14-16-28/h6-10,13-16,18,20-22,24-25,29,34H,11-12,17,19H2,1-5H3,(H,36,38)/b34-20+,35-30+ |
| InChIKey | JNELXXHWBKIIDL-XWOUFDNDSA-N |
| XLogP | 7.87 |
| TPSA | 68.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.71 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|