C19H21N — CID 90882640
7-(4,5,6,7-tetrahydroinden-5-ylmethyl)-1,2,3,4-tetrahydroquinoline (PubChem CID 90882640) has the molecular formula C19H21N and a molecular weight of 263.38 g/mol. Its IUPAC name is 7-(4,5,6,7-tetrahydroinden-5-ylmethyl)-1,2,3,4-tetrahydroquinoline.
| Compound Name | 7-(4,5,6,7-tetrahydroinden-5-ylmethyl)-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 90882640 |
| Molecular Formula | C19H21N |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | 7-(4,5,6,7-tetrahydroinden-5-ylmethyl)-1,2,3,4-tetrahydroquinoline |
| SMILES | C1=CC2=C(C=1)CC(Cc1ccc3c(c1)NCCC3)CC2 |
| InChI | InChI=1S/C19H21N/c1-3-16-8-6-14(12-18(16)4-1)11-15-7-9-17-5-2-10-20-19(17)13-15/h3-4,7,9,13-14,20H,2,5-6,8,10-12H2 |
| InChIKey | JAQRBJTYYHNJMR-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |