C18H20ClNO3S — CID 90882697
N-[(2-chlorophenyl)methyl]-4-(4-hydroxyphenyl)sulfinylpentanamide (PubChem CID 90882697) has the molecular formula C18H20ClNO3S and a molecular weight of 365.88 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-4-(4-hydroxyphenyl)sulfinylpentanamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-4-(4-hydroxyphenyl)sulfinylpentanamide |
|---|---|
| PubChem CID | 90882697 |
| Molecular Formula | C18H20ClNO3S |
| Molecular Weight | 365.88 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-4-(4-hydroxyphenyl)sulfinylpentanamide |
| SMILES | CC(CCC(=O)NCc1ccccc1Cl)S(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C18H20ClNO3S/c1-13(24(23)16-9-7-15(21)8-10-16)6-11-18(22)20-12-14-4-2-3-5-17(14)19/h2-5,7-10,13,21H,6,11-12H2,1H3,(H,20,22) |
| InChIKey | VQDJWLFDQVPLPY-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.88 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |