C18H20O5 — CID 90882867
(1S,4S,5R,8S,9R,12S)-5,8-dimethyl-3,10,14-trioxotetracyclo[10.2.1.02,11.04,9]pentadec-6-ene-4-carboxylic acid (PubChem CID 90882867) has the molecular formula C18H20O5 and a molecular weight of 316.35 g/mol. Its IUPAC name is (1S,4S,5R,8S,9R,12S)-5,8-dimethyl-3,10,14-trioxotetracyclo[10.2.1.02,11.04,9]pentadec-6-ene-4-carboxylic acid.
| Compound Name | (1S,4S,5R,8S,9R,12S)-5,8-dimethyl-3,10,14-trioxotetracyclo[10.2.1.02,11.04,9]pentadec-6-ene-4-carboxylic acid |
|---|---|
| PubChem CID | 90882867 |
| Molecular Formula | C18H20O5 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | (1S,4S,5R,8S,9R,12S)-5,8-dimethyl-3,10,14-trioxotetracyclo[10.2.1.02,11.04,9]pentadec-6-ene-4-carboxylic acid |
| SMILES | C[C@@H]1C=C[C@H](C)[C@H]2C(=O)C3C(C(=O)[C@]12C(=O)O)[C@@H]1C[C@H]3CC1=O |
| InChI | InChI=1S/C18H20O5/c1-7-3-4-8(2)18(17(22)23)14(7)15(20)12-9-5-10(11(19)6-9)13(12)16(18)21/h3-4,7-10,12-14H,5-6H2,1-2H3,(H,22,23)/t7-,8+,9-,10+,12?,13?,14-,18-/m0/s1 |
| InChIKey | FIUFSQGFZIRHBI-ZTTANUGASA-N |
| XLogP | 1.51 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|