About 2-cyclohexyl-N-ethyl-1,2,4-triazol-3-amine;ethane
2-cyclohexyl-N-ethyl-1,2,4-triazol-3-amine;ethane (PubChem CID 90882940) has the molecular formula C12H24N4
and a molecular weight of 224.35 g/mol. Its IUPAC name is 2-cyclohexyl-N-ethyl-1,2,4-triazol-3-amine;ethane.
Molecular Properties
| Compound Name | 2-cyclohexyl-N-ethyl-1,2,4-triazol-3-amine;ethane |
| PubChem CID | 90882940 |
| Molecular Formula | C12H24N4 |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.20 |
| IUPAC Name | 2-cyclohexyl-N-ethyl-1,2,4-triazol-3-amine;ethane |
| SMILES | CC.CCNc1ncnn1C1CCCCC1 |
| InChI | InChI=1S/C10H18N4.C2H6/c1-2-11-10-12-8-13-14(10)9-6-4-3-5-7-9;1-2/h8-9H,2-7H2,1H3,(H,11,12,13);1-2H3 |
| InChIKey | QSCSAKSMEGNJTN-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-cyclohexyl-N-ethyl-1,2,4-triazol-3-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexyl-N-ethyl-1,2,4-triazol-3-amine;ethane?
The IUPAC name of 2-cyclohexyl-N-ethyl-1,2,4-triazol-3-amine;ethane (CID 90882940) is 2-cyclohexyl-N-ethyl-1,2,4-triazol-3-amine;ethane.
What is the SMILES notation for 2-cyclohexyl-N-ethyl-1,2,4-triazol-3-amine;ethane?
The canonical SMILES for 2-cyclohexyl-N-ethyl-1,2,4-triazol-3-amine;ethane is CC.CCNc1ncnn1C1CCCCC1.
What is the InChIKey of 2-cyclohexyl-N-ethyl-1,2,4-triazol-3-amine;ethane?
The InChIKey is QSCSAKSMEGNJTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N4.C2H6/c1-2-11-10-12-8-13-14(10)9-6-4-3-5-7-9;1-2/h8-9H,2-7H2,1H3,(H,11,12,13);1-2H3.
What are the key properties of 2-cyclohexyl-N-ethyl-1,2,4-triazol-3-amine;ethane?
2-cyclohexyl-N-ethyl-1,2,4-triazol-3-amine;ethane has a molecular weight of 224.35 g/mol, XLogP of 3.24, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyl-N-ethyl-1,2,4-triazol-3-amine;ethane is sourced from PubChem (CID 90882940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).