C23H26NOP — CID 90883311
diphenyl-[(5S)-5-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]cyclopenten-1-yl]phosphane (PubChem CID 90883311) has the molecular formula C23H26NOP and a molecular weight of 363.44 g/mol. Its IUPAC name is diphenyl-[(5S)-5-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]cyclopenten-1-yl]phosphane.
| Compound Name | diphenyl-[(5S)-5-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]cyclopenten-1-yl]phosphane |
|---|---|
| PubChem CID | 90883311 |
| Molecular Formula | C23H26NOP |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | diphenyl-[(5S)-5-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]cyclopenten-1-yl]phosphane |
| SMILES | CC(C)[C@H]1COC([C@@H]2CCC=C2P(c2ccccc2)c2ccccc2)=N1 |
| InChI | InChI=1S/C23H26NOP/c1-17(2)21-16-25-23(24-21)20-14-9-15-22(20)26(18-10-5-3-6-11-18)19-12-7-4-8-13-19/h3-8,10-13,15,17,20-21H,9,14,16H2,1-2H3/t20-,21-/m1/s1 |
| InChIKey | BBSTYIGISXBTEV-NHCUHLMSSA-N |
| XLogP | 4.87 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|