About 6-bromo-N-cyclopropyl-1,2-benzoxazol-3-amine;ethane
6-bromo-N-cyclopropyl-1,2-benzoxazol-3-amine;ethane (PubChem CID 90883521) has the molecular formula C12H15BrN2O
and a molecular weight of 283.17 g/mol. Its IUPAC name is 6-bromo-N-cyclopropyl-1,2-benzoxazol-3-amine;ethane.
Molecular Properties
| Compound Name | 6-bromo-N-cyclopropyl-1,2-benzoxazol-3-amine;ethane |
| PubChem CID | 90883521 |
| Molecular Formula | C12H15BrN2O |
| Molecular Weight | 283.17 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | 6-bromo-N-cyclopropyl-1,2-benzoxazol-3-amine;ethane |
| SMILES | Brc1ccc2c(NC3CC3)noc2c1.CC |
| InChI | InChI=1S/C10H9BrN2O.C2H6/c11-6-1-4-8-9(5-6)14-13-10(8)12-7-2-3-7;1-2/h1,4-5,7H,2-3H2,(H,12,13);1-2H3 |
| InChIKey | XVBUPFXWPSOIKB-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.17 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-bromo-N-cyclopropyl-1,2-benzoxazol-3-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-N-cyclopropyl-1,2-benzoxazol-3-amine;ethane?
The IUPAC name of 6-bromo-N-cyclopropyl-1,2-benzoxazol-3-amine;ethane (CID 90883521) is 6-bromo-N-cyclopropyl-1,2-benzoxazol-3-amine;ethane.
What is the SMILES notation for 6-bromo-N-cyclopropyl-1,2-benzoxazol-3-amine;ethane?
The canonical SMILES for 6-bromo-N-cyclopropyl-1,2-benzoxazol-3-amine;ethane is Brc1ccc2c(NC3CC3)noc2c1.CC.
What is the InChIKey of 6-bromo-N-cyclopropyl-1,2-benzoxazol-3-amine;ethane?
The InChIKey is XVBUPFXWPSOIKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9BrN2O.C2H6/c11-6-1-4-8-9(5-6)14-13-10(8)12-7-2-3-7;1-2/h1,4-5,7H,2-3H2,(H,12,13);1-2H3.
What are the key properties of 6-bromo-N-cyclopropyl-1,2-benzoxazol-3-amine;ethane?
6-bromo-N-cyclopropyl-1,2-benzoxazol-3-amine;ethane has a molecular weight of 283.17 g/mol, XLogP of 4.19, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-N-cyclopropyl-1,2-benzoxazol-3-amine;ethane is sourced from PubChem (CID 90883521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).