C18H25FS — CID 90883770
(1R,2S,10S,11S,15S)-14-fluoro-2,15-dimethyl-17-thiatetracyclo[8.7.0.02,7.011,15]heptadeca-3,5-diene (PubChem CID 90883770) has the molecular formula C18H25FS and a molecular weight of 292.46 g/mol. Its IUPAC name is (1R,2S,10S,11S,15S)-14-fluoro-2,15-dimethyl-17-thiatetracyclo[8.7.0.02,7.011,15]heptadeca-3,5-diene.
| Compound Name | (1R,2S,10S,11S,15S)-14-fluoro-2,15-dimethyl-17-thiatetracyclo[8.7.0.02,7.011,15]heptadeca-3,5-diene |
|---|---|
| PubChem CID | 90883770 |
| Molecular Formula | C18H25FS |
| Molecular Weight | 292.46 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | (1R,2S,10S,11S,15S)-14-fluoro-2,15-dimethyl-17-thiatetracyclo[8.7.0.02,7.011,15]heptadeca-3,5-diene |
| SMILES | C[C@]12C=CC=CC1CC[C@@H]1[C@H]2SC[C@]2(C)C(F)CC[C@@H]12 |
| InChI | InChI=1S/C18H25FS/c1-17-10-4-3-5-12(17)6-7-13-14-8-9-15(19)18(14,2)11-20-16(13)17/h3-5,10,12-16H,6-9,11H2,1-2H3/t12?,13-,14-,15?,16+,17-,18-/m0/s1 |
| InChIKey | VELLGQUILOEKQG-NRPDHOTLSA-N |
| XLogP | 5.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.46 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |