About 1-hydrazinyl-N,2-dimethylpropan-1-amine
1-hydrazinyl-N,2-dimethylpropan-1-amine (PubChem CID 90884696) has the molecular formula C5H15N3
and a molecular weight of 117.20 g/mol. Its IUPAC name is 1-hydrazinyl-N,2-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | 1-hydrazinyl-N,2-dimethylpropan-1-amine |
| PubChem CID | 90884696 |
| Molecular Formula | C5H15N3 |
| Molecular Weight | 117.20 g/mol |
| Exact Mass | 117.13 |
| IUPAC Name | 1-hydrazinyl-N,2-dimethylpropan-1-amine |
| SMILES | CNC(NN)C(C)C |
| InChI | InChI=1S/C5H15N3/c1-4(2)5(7-3)8-6/h4-5,7-8H,6H2,1-3H3 |
| InChIKey | SCKXRIDNMPZZPM-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.20 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-hydrazinyl-N,2-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydrazinyl-N,2-dimethylpropan-1-amine?
The IUPAC name of 1-hydrazinyl-N,2-dimethylpropan-1-amine (CID 90884696) is 1-hydrazinyl-N,2-dimethylpropan-1-amine.
What is the SMILES notation for 1-hydrazinyl-N,2-dimethylpropan-1-amine?
The canonical SMILES for 1-hydrazinyl-N,2-dimethylpropan-1-amine is CNC(NN)C(C)C.
What is the InChIKey of 1-hydrazinyl-N,2-dimethylpropan-1-amine?
The InChIKey is SCKXRIDNMPZZPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H15N3/c1-4(2)5(7-3)8-6/h4-5,7-8H,6H2,1-3H3.
What are the key properties of 1-hydrazinyl-N,2-dimethylpropan-1-amine?
1-hydrazinyl-N,2-dimethylpropan-1-amine has a molecular weight of 117.20 g/mol, XLogP of -0.35, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydrazinyl-N,2-dimethylpropan-1-amine is sourced from PubChem (CID 90884696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).